C41H50N4O6 — CID 142841405
2-[[(2S)-7-amino-2-[[2-amino-3-[5-(3-methyl-4-phenylmethoxyphenyl)-2-phenylmethoxyphenyl]propanoyl]amino]heptanoyl]-methylamino]propanoic acid (PubChem CID 142841405) has the molecular formula C41H50N4O6 and a molecular weight of 694.87 g/mol. Its IUPAC name is 2-[[(2S)-7-amino-2-[[2-amino-3-[5-(3-methyl-4-phenylmethoxyphenyl)-2-phenylmethoxyphenyl]propanoyl]amino]heptanoyl]-methylamino]propanoic acid.
| Compound Name | 2-[[(2S)-7-amino-2-[[2-amino-3-[5-(3-methyl-4-phenylmethoxyphenyl)-2-phenylmethoxyphenyl]propanoyl]amino]heptanoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 142841405 |
| Molecular Formula | C41H50N4O6 |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | 2-[[(2S)-7-amino-2-[[2-amino-3-[5-(3-methyl-4-phenylmethoxyphenyl)-2-phenylmethoxyphenyl]propanoyl]amino]heptanoyl]-methylamino]propanoic acid |
| SMILES | Cc1cc(-c2ccc(OCc3ccccc3)c(CC(N)C(=O)N[C@@H](CCCCCN)C(=O)N(C)C(C)C(=O)O)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C41H50N4O6/c1-28-23-32(18-20-37(28)50-26-30-13-7-4-8-14-30)33-19-21-38(51-27-31-15-9-5-10-16-31)34(24-33)25-35(43)39(46)44-36(17-11-6-12-22-42)40(47)45(3)29(2)41(48)49/h4-5,7-10,13-16,18-21,23-24,29,35-36H,6,11-12,17,22,25-27,42-43H2,1-3H3,(H,44,46)(H,48,49)/t29?,35?,36-/m0/s1 |
| InChIKey | BPMYGGWYYGXVNC-HNUJRMHDSA-N |
| XLogP | 5.63 |
| TPSA | 157.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|