C19H27NO2 — CID 58901335
(E)-N-[(4R)-2,6-dimethyl-3-oxoheptan-4-yl]-N-methyl-3-phenylprop-2-enamide (PubChem CID 58901335) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (E)-N-[(4R)-2,6-dimethyl-3-oxoheptan-4-yl]-N-methyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4R)-2,6-dimethyl-3-oxoheptan-4-yl]-N-methyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 58901335 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (E)-N-[(4R)-2,6-dimethyl-3-oxoheptan-4-yl]-N-methyl-3-phenylprop-2-enamide |
| SMILES | CC(C)C[C@H](C(=O)C(C)C)N(C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H27NO2/c1-14(2)13-17(19(22)15(3)4)20(5)18(21)12-11-16-9-7-6-8-10-16/h6-12,14-15,17H,13H2,1-5H3/b12-11+/t17-/m1/s1 |
| InChIKey | VZDXXZNLTHIKPC-FMQWLBJXSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|