C30H29FO6S2 — CID 58903120
ethyl 3-[4-[[3-(2,6-dimethyl-4-thiophen-3-ylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate (PubChem CID 58903120) has the molecular formula C30H29FO6S2 and a molecular weight of 568.69 g/mol. Its IUPAC name is ethyl 3-[4-[[3-(2,6-dimethyl-4-thiophen-3-ylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate.
| Compound Name | ethyl 3-[4-[[3-(2,6-dimethyl-4-thiophen-3-ylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 58903120 |
| Molecular Formula | C30H29FO6S2 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | ethyl 3-[4-[[3-(2,6-dimethyl-4-thiophen-3-ylsulfonyloxyphenyl)phenyl]methoxy]-2-fluorophenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCc2cccc(-c3c(C)cc(OS(=O)(=O)c4ccsc4)cc3C)c2)cc1F |
| InChI | InChI=1S/C30H29FO6S2/c1-4-35-29(32)11-9-23-8-10-25(17-28(23)31)36-18-22-6-5-7-24(16-22)30-20(2)14-26(15-21(30)3)37-39(33,34)27-12-13-38-19-27/h5-8,10,12-17,19H,4,9,11,18H2,1-3H3 |
| InChIKey | HJLFFAYNBJFHOP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|