C39H43FN2O10S2 — CID 59434118
ethyl 3-[2-fluoro-4-[[3-[4-[(4-methoxy-1,1-dioxothian-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate (PubChem CID 59434118) has the molecular formula C39H43FN2O10S2 and a molecular weight of 782.91 g/mol. Its IUPAC name is ethyl 3-[2-fluoro-4-[[3-[4-[(4-methoxy-1,1-dioxothian-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate.
| Compound Name | ethyl 3-[2-fluoro-4-[[3-[4-[(4-methoxy-1,1-dioxothian-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 59434118 |
| Molecular Formula | C39H43FN2O10S2 |
| Molecular Weight | 782.91 g/mol |
| Exact Mass | 782.23 |
| IUPAC Name | ethyl 3-[2-fluoro-4-[[3-[4-[(4-methoxy-1,1-dioxothian-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(N(Cc2cccc(-c3c(C)cc(OCC4(OC)CCS(=O)(=O)CC4)cc3C)c2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C39H43FN2O10S2/c1-5-51-37(43)16-14-30-13-15-32(24-34(30)40)41(54(48,49)36-12-7-6-11-35(36)42(44)45)25-29-9-8-10-31(23-29)38-27(2)21-33(22-28(38)3)52-26-39(50-4)17-19-53(46,47)20-18-39/h6-13,15,21-24H,5,14,16-20,25-26H2,1-4H3 |
| InChIKey | CEZWZCKNDCULAN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 159.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.91 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|