C34H30N2O6S — CID 23157560
methyl 3-[4-[[3-(2-methylnaphthalen-1-yl)phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate (PubChem CID 23157560) has the molecular formula C34H30N2O6S and a molecular weight of 594.69 g/mol. Its IUPAC name is methyl 3-[4-[[3-(2-methylnaphthalen-1-yl)phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[3-(2-methylnaphthalen-1-yl)phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 23157560 |
| Molecular Formula | C34H30N2O6S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | methyl 3-[4-[[3-(2-methylnaphthalen-1-yl)phenyl]methyl-(2-nitrophenyl)sulfonylamino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(N(Cc2cccc(-c3c(C)ccc4ccccc34)c2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H30N2O6S/c1-24-14-18-27-9-3-4-11-30(27)34(24)28-10-7-8-26(22-28)23-35(29-19-15-25(16-20-29)17-21-33(37)42-2)43(40,41)32-13-6-5-12-31(32)36(38)39/h3-16,18-20,22H,17,21,23H2,1-2H3 |
| InChIKey | XKMYHVUPYIFMOD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|