C34H39O3S+ — CID 58908064
[5-tert-butyl-2-(4-tert-butylphenoxy)phenyl]-bis(4-methoxyphenyl)sulfanium (PubChem CID 58908064) has the molecular formula C34H39O3S+ and a molecular weight of 527.75 g/mol. Its IUPAC name is [5-tert-butyl-2-(4-tert-butylphenoxy)phenyl]-bis(4-methoxyphenyl)sulfanium.
| Compound Name | [5-tert-butyl-2-(4-tert-butylphenoxy)phenyl]-bis(4-methoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 58908064 |
| Molecular Formula | C34H39O3S+ |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | [5-tert-butyl-2-(4-tert-butylphenoxy)phenyl]-bis(4-methoxyphenyl)sulfanium |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)c2cc(C(C)(C)C)ccc2Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H39O3S/c1-33(2,3)24-9-12-28(13-10-24)37-31-22-11-25(34(4,5)6)23-32(31)38(29-18-14-26(35-7)15-19-29)30-20-16-27(36-8)17-21-30/h9-23H,1-8H3/q+1 |
| InChIKey | JHUZTQIDHBVROF-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|