C25H39N3O7 — CID 58908752
methyl 2-[1-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]cyclopropyl]-2-oxoacetate (PubChem CID 58908752) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl 2-[1-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]cyclopropyl]-2-oxoacetate.
| Compound Name | methyl 2-[1-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]cyclopropyl]-2-oxoacetate |
|---|---|
| PubChem CID | 58908752 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | methyl 2-[1-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]cyclopropyl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1(NC(=O)[C@@H]2[C@@H]3[C@H](CN2C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C3(C)C)CC1 |
| InChI | InChI=1S/C25H39N3O7/c1-22(2,3)16(26-21(33)35-23(4,5)6)19(31)28-12-13-14(24(13,7)8)15(28)18(30)27-25(10-11-25)17(29)20(32)34-9/h13-16H,10-12H2,1-9H3,(H,26,33)(H,27,30)/t13-,14-,15-,16+/m0/s1 |
| InChIKey | LIHGPXHYJHXAPP-YHUYYLMFSA-N |
| XLogP | 1.80 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|