C18H17NO3S — CID 58912495
(2Z)-3-(9H-fluoren-9-ylmethylsulfanyl)-2-methoxyiminopropanoic acid (PubChem CID 58912495) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is (2Z)-3-(9H-fluoren-9-ylmethylsulfanyl)-2-methoxyiminopropanoic acid.
| Compound Name | (2Z)-3-(9H-fluoren-9-ylmethylsulfanyl)-2-methoxyiminopropanoic acid |
|---|---|
| PubChem CID | 58912495 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2Z)-3-(9H-fluoren-9-ylmethylsulfanyl)-2-methoxyiminopropanoic acid |
| SMILES | CO/N=C(\CSCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C18H17NO3S/c1-22-19-17(18(20)21)11-23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3,(H,20,21)/b19-17+ |
| InChIKey | AISKQZIHFOTBQG-HTXNQAPBSA-N |
| XLogP | 3.62 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|