C42H56O4 — CID 58913835
dimethyl (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,30E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaenedioate (PubChem CID 58913835) has the molecular formula C42H56O4 and a molecular weight of 624.91 g/mol. Its IUPAC name is dimethyl (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,30E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaenedioate.
| Compound Name | dimethyl (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,30E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaenedioate |
|---|---|
| PubChem CID | 58913835 |
| Molecular Formula | C42H56O4 |
| Molecular Weight | 624.91 g/mol |
| Exact Mass | 624.42 |
| IUPAC Name | dimethyl (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,30E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaenedioate |
| SMILES | COC(=O)/C(C)=C/CC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CC/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C42H56O4/c1-33(21-13-23-35(3)25-15-27-37(5)29-17-31-39(7)41(43)45-9)19-11-12-20-34(2)22-14-24-36(4)26-16-28-38(6)30-18-32-40(8)42(44)46-10/h11-16,19-28,31-32H,17-18,29-30H2,1-10H3/b12-11+,21-13+,22-14+,25-15+,26-16+,33-19+,34-20+,35-23+,36-24+,37-27+,38-28+,39-31+,40-32+ |
| InChIKey | WCNFOWGUNHDZIR-LKQOBHBSSA-N |
| XLogP | 11.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.91 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|