C40H36IrN2O2S2-2 — CID 58914251
bis(2-(3H-1-benzothiophen-3-id-2-yl)pyridine);6-(4-ethenylphenyl)hexane-2,4-diol;iridium (PubChem CID 58914251) has the molecular formula C40H36IrN2O2S2-2 and a molecular weight of 833.09 g/mol. Its IUPAC name is bis(2-(3H-1-benzothiophen-3-id-2-yl)pyridine);6-(4-ethenylphenyl)hexane-2,4-diol;iridium.
| Compound Name | bis(2-(3H-1-benzothiophen-3-id-2-yl)pyridine);6-(4-ethenylphenyl)hexane-2,4-diol;iridium |
|---|---|
| PubChem CID | 58914251 |
| Molecular Formula | C40H36IrN2O2S2-2 |
| Molecular Weight | 833.09 g/mol |
| Exact Mass | 833.19 |
| IUPAC Name | bis(2-(3H-1-benzothiophen-3-id-2-yl)pyridine);6-(4-ethenylphenyl)hexane-2,4-diol;iridium |
| SMILES | C=Cc1ccc(CCC(O)CC(C)O)cc1.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12.[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C14H20O2.2C13H8NS.Ir/c1-3-12-4-6-13(7-5-12)8-9-14(16)10-11(2)15;2*1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h3-7,11,14-16H,1,8-10H2,2H3;2*1-8H;/q;2*-1; |
| InChIKey | HQLLXCGUARGJJQ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.09 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|