C18H20IrNO2S- — CID 20746435
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-diol (PubChem CID 20746435) has the molecular formula C18H20IrNO2S- and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-diol.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-diol |
|---|---|
| PubChem CID | 20746435 |
| Molecular Formula | C18H20IrNO2S- |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;iridium;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C13H8NS.C5H12O2.Ir/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;1-4(6)3-5(2)7;/h1-8H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | JMGQYZJOLCABRW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|