C19H12O — CID 58915735
4-oxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene (PubChem CID 58915735) has the molecular formula C19H12O and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-oxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene.
| Compound Name | 4-oxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 58915735 |
| Molecular Formula | C19H12O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-oxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(20),2(9),3(7),5,10,12,14,16,18-nonaene |
| SMILES | c1ccc2cc3c4c(ccc3cc2c1)Cc1ccoc1-4 |
| InChI | InChI=1S/C19H12O/c1-2-4-13-11-17-14(9-12(13)3-1)5-6-15-10-16-7-8-20-19(16)18(15)17/h1-9,11H,10H2 |
| InChIKey | KNCYKUOUIGUABA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|