C17H24FN5O4 — CID 58916096
2-amino-N-[(2S,3R,5R)-5-(4-amino-7-fluorobenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]pentanamide (PubChem CID 58916096) has the molecular formula C17H24FN5O4 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-amino-N-[(2S,3R,5R)-5-(4-amino-7-fluorobenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]pentanamide.
| Compound Name | 2-amino-N-[(2S,3R,5R)-5-(4-amino-7-fluorobenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 58916096 |
| Molecular Formula | C17H24FN5O4 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-amino-N-[(2S,3R,5R)-5-(4-amino-7-fluorobenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]pentanamide |
| SMILES | CCCC(N)C(=O)N[C@@H]1C(O)[C@H](n2cnc3c(N)ccc(F)c32)O[C@@H]1CO |
| InChI | InChI=1S/C17H24FN5O4/c1-2-3-10(20)16(26)22-13-11(6-24)27-17(15(13)25)23-7-21-12-9(19)5-4-8(18)14(12)23/h4-5,7,10-11,13,15,17,24-25H,2-3,6,19-20H2,1H3,(H,22,26)/t10?,11-,13+,15?,17-/m1/s1 |
| InChIKey | QLJDAWLARIUDMO-GVSMZRMYSA-N |
| XLogP | -0.38 |
| TPSA | 148.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|