C22H17ClF2N2O2 — CID 58919705
3-[4-chloro-5-(4-fluorobenzoyl)-2-pyridinyl]-N-ethyl-5-fluoro-4-methylbenzamide (PubChem CID 58919705) has the molecular formula C22H17ClF2N2O2 and a molecular weight of 414.84 g/mol. Its IUPAC name is 3-[4-chloro-5-(4-fluorobenzoyl)-2-pyridinyl]-N-ethyl-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[4-chloro-5-(4-fluorobenzoyl)-2-pyridinyl]-N-ethyl-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 58919705 |
| Molecular Formula | C22H17ClF2N2O2 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-[4-chloro-5-(4-fluorobenzoyl)-2-pyridinyl]-N-ethyl-5-fluoro-4-methylbenzamide |
| SMILES | CCNC(=O)c1cc(F)c(C)c(-c2cc(Cl)c(C(=O)c3ccc(F)cc3)cn2)c1 |
| InChI | InChI=1S/C22H17ClF2N2O2/c1-3-26-22(29)14-8-16(12(2)19(25)9-14)20-10-18(23)17(11-27-20)21(28)13-4-6-15(24)7-5-13/h4-11H,3H2,1-2H3,(H,26,29) |
| InChIKey | RIWPBVFJBGWDPW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |