C22H26ClN3O5 — CID 58922982
N-[(4-chlorophenyl)methyl]-2,3-dihydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanamide (PubChem CID 58922982) has the molecular formula C22H26ClN3O5 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2,3-dihydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2,3-dihydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 58922982 |
| Molecular Formula | C22H26ClN3O5 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2,3-dihydroxy-4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxobutanamide |
| SMILES | COc1ccc(N2CCN(C(=O)C(O)C(O)C(=O)NCc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O5/c1-31-18-8-6-17(7-9-18)25-10-12-26(13-11-25)22(30)20(28)19(27)21(29)24-14-15-2-4-16(23)5-3-15/h2-9,19-20,27-28H,10-14H2,1H3,(H,24,29) |
| InChIKey | FIZIYYBIOMVCOM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|