C21H21N3O6S2 — CID 58924134
2-[(5-methoxy-3-pyridinyl)sulfamoyl]-N-[(4-methylsulfonylphenyl)methyl]benzamide (PubChem CID 58924134) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[(5-methoxy-3-pyridinyl)sulfamoyl]-N-[(4-methylsulfonylphenyl)methyl]benzamide.
| Compound Name | 2-[(5-methoxy-3-pyridinyl)sulfamoyl]-N-[(4-methylsulfonylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58924134 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2-[(5-methoxy-3-pyridinyl)sulfamoyl]-N-[(4-methylsulfonylphenyl)methyl]benzamide |
| SMILES | COc1cncc(NS(=O)(=O)c2ccccc2C(=O)NCc2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C21H21N3O6S2/c1-30-17-11-16(13-22-14-17)24-32(28,29)20-6-4-3-5-19(20)21(25)23-12-15-7-9-18(10-8-15)31(2,26)27/h3-11,13-14,24H,12H2,1-2H3,(H,23,25) |
| InChIKey | VQIZOYAAKPTIBA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |