C21H20ClN3O4S — CID 58924321
N-[2-(2-chlorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide (PubChem CID 58924321) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(2-chlorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 58924321 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[2-(2-chlorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide |
| SMILES | COc1cncc(NS(=O)(=O)c2ccccc2C(=O)NCCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H20ClN3O4S/c1-29-17-12-16(13-23-14-17)25-30(27,28)20-9-5-3-7-18(20)21(26)24-11-10-15-6-2-4-8-19(15)22/h2-9,12-14,25H,10-11H2,1H3,(H,24,26) |
| InChIKey | WYDFZTPBMVKRGJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |