C21H19F2N3O4S — CID 58924145
N-[2-(2,5-difluorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide (PubChem CID 58924145) has the molecular formula C21H19F2N3O4S and a molecular weight of 447.46 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(2,5-difluorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 58924145 |
| Molecular Formula | C21H19F2N3O4S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)ethyl]-2-[(5-methoxy-3-pyridinyl)sulfamoyl]benzamide |
| SMILES | COc1cncc(NS(=O)(=O)c2ccccc2C(=O)NCCc2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C21H19F2N3O4S/c1-30-17-11-16(12-24-13-17)26-31(28,29)20-5-3-2-4-18(20)21(27)25-9-8-14-10-15(22)6-7-19(14)23/h2-7,10-13,26H,8-9H2,1H3,(H,25,27) |
| InChIKey | BKFRLCHKKFLSFV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |