About [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate
[hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate (PubChem CID 58925531) has the molecular formula C10H32O10Si5
and a molecular weight of 452.79 g/mol. Its IUPAC name is [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate.
Molecular Properties
| Compound Name | [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate |
| PubChem CID | 58925531 |
| Molecular Formula | C10H32O10Si5 |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate |
| SMILES | CO[Si](O)(OC)O[Si](OC)(OC)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C10H32O10Si5/c1-13-24(12,14-2)20-25(15-3,16-4)19-23(9,10)18-22(7,8)17-21(5,6)11/h11-12H,1-10H3 |
| InChIKey | BUKOPLJGKYAEOI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate?
The IUPAC name of [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate (CID 58925531) is [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate.
What is the SMILES notation for [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate?
The canonical SMILES for [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate is CO[Si](O)(OC)O[Si](OC)(OC)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O.
What is the InChIKey of [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate?
The InChIKey is BUKOPLJGKYAEOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H32O10Si5/c1-13-24(12,14-2)20-25(15-3,16-4)19-23(9,10)18-22(7,8)17-21(5,6)11/h11-12H,1-10H3.
What are the key properties of [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate?
[hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate has a molecular weight of 452.79 g/mol, XLogP of 0.60, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [hydroxy(dimethoxy)silyl] [[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl] dimethyl silicate is sourced from PubChem (CID 58925531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).