C5H16O5Si2 — CID 18737486
hydroxy-dimethoxy-[methoxy(dimethyl)silyl]oxysilane (PubChem CID 18737486) has the molecular formula C5H16O5Si2 and a molecular weight of 212.35 g/mol. Its IUPAC name is hydroxy-dimethoxy-[methoxy(dimethyl)silyl]oxysilane.
| Compound Name | hydroxy-dimethoxy-[methoxy(dimethyl)silyl]oxysilane |
|---|---|
| PubChem CID | 18737486 |
| Molecular Formula | C5H16O5Si2 |
| Molecular Weight | 212.35 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | hydroxy-dimethoxy-[methoxy(dimethyl)silyl]oxysilane |
| SMILES | CO[Si](C)(C)O[Si](O)(OC)OC |
| InChI | InChI=1S/C5H16O5Si2/c1-7-11(4,5)10-12(6,8-2)9-3/h6H,1-5H3 |
| InChIKey | LZFHDWMGWKIHHA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|