C10H30O4Si3 — CID 161119719
methoxy-[methoxy(dimethyl)silyl]oxy-dimethylsilane;methoxy(trimethyl)silane (PubChem CID 161119719) has the molecular formula C10H30O4Si3 and a molecular weight of 298.60 g/mol. Its IUPAC name is methoxy-[methoxy(dimethyl)silyl]oxy-dimethylsilane;methoxy(trimethyl)silane.
| Compound Name | methoxy-[methoxy(dimethyl)silyl]oxy-dimethylsilane;methoxy(trimethyl)silane |
|---|---|
| PubChem CID | 161119719 |
| Molecular Formula | C10H30O4Si3 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methoxy-[methoxy(dimethyl)silyl]oxy-dimethylsilane;methoxy(trimethyl)silane |
| SMILES | CO[Si](C)(C)C.CO[Si](C)(C)O[Si](C)(C)OC |
| InChI | InChI=1S/C6H18O3Si2.C4H12OSi/c1-7-10(3,4)9-11(5,6)8-2;1-5-6(2,3)4/h1-6H3;1-4H3 |
| InChIKey | UKUDEYZNZDWQFH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|