C12H36O6Si5 — CID 23370780
bis[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane (PubChem CID 23370780) has the molecular formula C12H36O6Si5 and a molecular weight of 416.84 g/mol. Its IUPAC name is bis[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane.
| Compound Name | bis[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 23370780 |
| Molecular Formula | C12H36O6Si5 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | bis[[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy]-dimethylsilane |
| SMILES | CO[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OC |
| InChI | InChI=1S/C12H36O6Si5/c1-13-19(3,4)15-21(7,8)17-23(11,12)18-22(9,10)16-20(5,6)14-2/h1-12H3 |
| InChIKey | UYAAQXMIDYJQPW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|