C16H21NO4S — CID 58926833
[6-(2-methylpentyl)-7-oxo-8H-naphthalen-2-yl] sulfamate (PubChem CID 58926833) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is [6-(2-methylpentyl)-7-oxo-8H-naphthalen-2-yl] sulfamate.
| Compound Name | [6-(2-methylpentyl)-7-oxo-8H-naphthalen-2-yl] sulfamate |
|---|---|
| PubChem CID | 58926833 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [6-(2-methylpentyl)-7-oxo-8H-naphthalen-2-yl] sulfamate |
| SMILES | CCCC(C)CC1=Cc2ccc(OS(N)(=O)=O)cc2CC1=O |
| InChI | InChI=1S/C16H21NO4S/c1-3-4-11(2)7-14-8-12-5-6-15(21-22(17,19)20)9-13(12)10-16(14)18/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H2,17,19,20) |
| InChIKey | FYKGOCUYABLNEO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |