C20H20F2N2O7 — CID 58929127
tert-butyl 2-[[2,2-difluoro-2-[2-(4-nitrophenoxy)phenoxy]acetyl]amino]acetate (PubChem CID 58929127) has the molecular formula C20H20F2N2O7 and a molecular weight of 438.38 g/mol. Its IUPAC name is tert-butyl 2-[[2,2-difluoro-2-[2-(4-nitrophenoxy)phenoxy]acetyl]amino]acetate.
| Compound Name | tert-butyl 2-[[2,2-difluoro-2-[2-(4-nitrophenoxy)phenoxy]acetyl]amino]acetate |
|---|---|
| PubChem CID | 58929127 |
| Molecular Formula | C20H20F2N2O7 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | tert-butyl 2-[[2,2-difluoro-2-[2-(4-nitrophenoxy)phenoxy]acetyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)C(F)(F)Oc1ccccc1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20F2N2O7/c1-19(2,3)31-17(25)12-23-18(26)20(21,22)30-16-7-5-4-6-15(16)29-14-10-8-13(9-11-14)24(27)28/h4-11H,12H2,1-3H3,(H,23,26) |
| InChIKey | JAKFSCBWFKCBAG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|