C30H35NO5 — CID 58929433
(4S)-5-(4-phenylmethoxyphenyl)-4-[3-(3-phenylpropoxy)propanoylamino]pentanoic acid (PubChem CID 58929433) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is (4S)-5-(4-phenylmethoxyphenyl)-4-[3-(3-phenylpropoxy)propanoylamino]pentanoic acid.
| Compound Name | (4S)-5-(4-phenylmethoxyphenyl)-4-[3-(3-phenylpropoxy)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 58929433 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (4S)-5-(4-phenylmethoxyphenyl)-4-[3-(3-phenylpropoxy)propanoylamino]pentanoic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CCOCCCc1ccccc1 |
| InChI | InChI=1S/C30H35NO5/c32-29(19-21-35-20-7-12-24-8-3-1-4-9-24)31-27(15-18-30(33)34)22-25-13-16-28(17-14-25)36-23-26-10-5-2-6-11-26/h1-6,8-11,13-14,16-17,27H,7,12,15,18-23H2,(H,31,32)(H,33,34)/t27-/m0/s1 |
| InChIKey | WCDUYNRKRFZKEB-MHZLTWQESA-N |
| XLogP | 5.20 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|