C20H23NO — CID 58930422
4-(cyclohexylmethyl)-N-(2-tritiophenyl)benzamide (PubChem CID 58930422) has the molecular formula C20H23NO and a molecular weight of 295.42 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-N-(2-tritiophenyl)benzamide.
| Compound Name | 4-(cyclohexylmethyl)-N-(2-tritiophenyl)benzamide |
|---|---|
| PubChem CID | 58930422 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-(cyclohexylmethyl)-N-(2-tritiophenyl)benzamide |
| SMILES | [3H]c1ccccc1NC(=O)c1ccc(CC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H23NO/c22-20(21-19-9-5-2-6-10-19)18-13-11-17(12-14-18)15-16-7-3-1-4-8-16/h2,5-6,9-14,16H,1,3-4,7-8,15H2,(H,21,22)/i9T |
| InChIKey | CKVCKIGEVQMSEJ-FIRFLZKJSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |