C24H27NO4 — CID 7628553
[2-(4-benzamidophenyl)-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 7628553) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 3-cyclohexylpropanoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 7628553 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO4/c26-22(17-29-23(27)16-11-18-7-3-1-4-8-18)19-12-14-21(15-13-19)25-24(28)20-9-5-2-6-10-20/h2,5-6,9-10,12-15,18H,1,3-4,7-8,11,16-17H2,(H,25,28) |
| InChIKey | NOGLFTUNBRIFBD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |