C16H19BrO3 — CID 23733164
[2-(3-bromophenyl)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 23733164) has the molecular formula C16H19BrO3 and a molecular weight of 339.23 g/mol. Its IUPAC name is [2-(3-bromophenyl)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(3-bromophenyl)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 23733164 |
| Molecular Formula | C16H19BrO3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [2-(3-bromophenyl)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | O=C(CCC1CCCC1)OCC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H19BrO3/c17-14-7-3-6-13(10-14)15(18)11-20-16(19)9-8-12-4-1-2-5-12/h3,6-7,10,12H,1-2,4-5,8-9,11H2 |
| InChIKey | VGNUNVXYYHZMHX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |