C24H25N5O2 — CID 58930570
N-(2-aminophenyl)-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzamide (PubChem CID 58930570) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 58930570 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CC(=O)N2CCN(c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c25-20-5-1-2-6-21(20)27-24(31)19-10-8-18(9-11-19)17-23(30)29-15-13-28(14-16-29)22-7-3-4-12-26-22/h1-12H,13-17,25H2,(H,27,31) |
| InChIKey | KTYYZJMZQSVGNR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|