C30H32N4O4 — CID 91440296
N-(2-aminophenyl)-4-[2-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-2-oxoethyl]benzamide (PubChem CID 91440296) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[2-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[2-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 91440296 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-(2-aminophenyl)-4-[2-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-2-oxoethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CC(=O)N2CCN(C(Cc3ccccc3)C3=COCO3)CC2)cc1 |
| InChI | InChI=1S/C30H32N4O4/c31-25-8-4-5-9-26(25)32-30(36)24-12-10-23(11-13-24)19-29(35)34-16-14-33(15-17-34)27(28-20-37-21-38-28)18-22-6-2-1-3-7-22/h1-13,20,27H,14-19,21,31H2,(H,32,36) |
| InChIKey | DCMAVLDZBXNRNN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|