C17H15NO3 — CID 58933230
2-(4-acetylphenyl)-7-methyl-3a,4-dihydroisoindole-1,3-dione (PubChem CID 58933230) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-7-methyl-3a,4-dihydroisoindole-1,3-dione.
| Compound Name | 2-(4-acetylphenyl)-7-methyl-3a,4-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 58933230 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(4-acetylphenyl)-7-methyl-3a,4-dihydroisoindole-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)C3=C(C)C=CCC3C2=O)cc1 |
| InChI | InChI=1S/C17H15NO3/c1-10-4-3-5-14-15(10)17(21)18(16(14)20)13-8-6-12(7-9-13)11(2)19/h3-4,6-9,14H,5H2,1-2H3 |
| InChIKey | RFJFGYKJROMLSI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|