C10H13F3N4O4 — CID 58935537
methyl 4-amino-5-carbamoyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-3-carboxylate (PubChem CID 58935537) has the molecular formula C10H13F3N4O4 and a molecular weight of 310.23 g/mol. Its IUPAC name is methyl 4-amino-5-carbamoyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-3-carboxylate.
| Compound Name | methyl 4-amino-5-carbamoyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 58935537 |
| Molecular Formula | C10H13F3N4O4 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | methyl 4-amino-5-carbamoyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(CCOCC(F)(F)F)c(C(N)=O)c1N |
| InChI | InChI=1S/C10H13F3N4O4/c1-20-9(19)6-5(14)7(8(15)18)17(16-6)2-3-21-4-10(11,12)13/h2-4,14H2,1H3,(H2,15,18) |
| InChIKey | QWYBTWRKSCCEAD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|