C20H25F2NO6 — CID 58936449
ethyl (5S)-5-[(1S)-2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxooxolane-3-carboxylate (PubChem CID 58936449) has the molecular formula C20H25F2NO6 and a molecular weight of 413.42 g/mol. Its IUPAC name is ethyl (5S)-5-[(1S)-2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (5S)-5-[(1S)-2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 58936449 |
| Molecular Formula | C20H25F2NO6 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | ethyl (5S)-5-[(1S)-2-(3,5-difluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]([C@H](Cc2cc(F)cc(F)c2)NC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C20H25F2NO6/c1-5-27-17(24)14-10-16(28-18(14)25)15(23-19(26)29-20(2,3)4)8-11-6-12(21)9-13(22)7-11/h6-7,9,14-16H,5,8,10H2,1-4H3,(H,23,26)/t14?,15-,16-/m0/s1 |
| InChIKey | DTRXSXJJFNBCRY-YVZMLIKISA-N |
| XLogP | 2.90 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|