C28H23IrN4O- — CID 58937523
2-(4,7-dihydrobenzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline (PubChem CID 58937523) has the molecular formula C28H23IrN4O- and a molecular weight of 623.74 g/mol. Its IUPAC name is 2-(4,7-dihydrobenzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline.
| Compound Name | 2-(4,7-dihydrobenzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline |
|---|---|
| PubChem CID | 58937523 |
| Molecular Formula | C28H23IrN4O- |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 2-(4,7-dihydrobenzotriazol-2-yl)-4-methylphenol;iridium;2-phenylquinoline |
| SMILES | Cc1ccc(O)c(-n2nc3c(n2)CC=CC3)c1.[Ir].[c-]1ccccc1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H10N.C13H13N3O.Ir/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16;/h1-6,8-11H;2-3,6-8,17H,4-5H2,1H3;/q-1;; |
| InChIKey | KVGIRYCCJODMMC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|