About carbanide;2-methylbutane;yttrium
carbanide;2-methylbutane;yttrium (PubChem CID 58937624) has the molecular formula C6H14Y-2
and a molecular weight of 175.08 g/mol. Its IUPAC name is carbanide;2-methylbutane;yttrium.
Molecular Properties
| Compound Name | carbanide;2-methylbutane;yttrium |
| PubChem CID | 58937624 |
| Molecular Formula | C6H14Y-2 |
| Molecular Weight | 175.08 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | carbanide;2-methylbutane;yttrium |
| SMILES | CC[C-](C)C.[CH3-].[Y] |
| InChI | InChI=1S/C5H11.CH3.Y/c1-4-5(2)3;;/h4H2,1-3H3;1H3;/q2*-1; |
| InChIKey | RMPFMBDZJHYXMC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.08 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-methylbutane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-methylbutane;yttrium?
The IUPAC name of carbanide;2-methylbutane;yttrium (CID 58937624) is carbanide;2-methylbutane;yttrium.
What is the SMILES notation for carbanide;2-methylbutane;yttrium?
The canonical SMILES for carbanide;2-methylbutane;yttrium is CC[C-](C)C.[CH3-].[Y].
What is the InChIKey of carbanide;2-methylbutane;yttrium?
The InChIKey is RMPFMBDZJHYXMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.CH3.Y/c1-4-5(2)3;;/h4H2,1-3H3;1H3;/q2*-1;.
What are the key properties of carbanide;2-methylbutane;yttrium?
carbanide;2-methylbutane;yttrium has a molecular weight of 175.08 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-methylbutane;yttrium is sourced from PubChem (CID 58937624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).