C12H15F9O2 — CID 58937685
(3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) 2-fluoro-2-methylbutanoate (PubChem CID 58937685) has the molecular formula C12H15F9O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) 2-fluoro-2-methylbutanoate.
| Compound Name | (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 58937685 |
| Molecular Formula | C12H15F9O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (3,3,4,4,5,5,6,6-octafluoro-2-methylhexan-2-yl) 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H15F9O2/c1-5-9(4,15)7(22)23-8(2,3)11(18,19)12(20,21)10(16,17)6(13)14/h6H,5H2,1-4H3 |
| InChIKey | SWDYXAGPQKCWLN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|