C22H30F8O4 — CID 58937708
2,2,3,3,4,4,5,5-octafluoropentyl 5,6-dimethyl-2-[2-(3-methylbutoxy)-2-oxoethyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58937708) has the molecular formula C22H30F8O4 and a molecular weight of 510.46 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 5,6-dimethyl-2-[2-(3-methylbutoxy)-2-oxoethyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 5,6-dimethyl-2-[2-(3-methylbutoxy)-2-oxoethyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58937708 |
| Molecular Formula | C22H30F8O4 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 5,6-dimethyl-2-[2-(3-methylbutoxy)-2-oxoethyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)CCOC(=O)CC1(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC2CC1C(C)C2C |
| InChI | InChI=1S/C22H30F8O4/c1-11(2)5-6-33-16(31)9-19(8-14-7-15(19)13(4)12(14)3)18(32)34-10-20(25,26)22(29,30)21(27,28)17(23)24/h11-15,17H,5-10H2,1-4H3 |
| InChIKey | OIPKHWIWCRBVEW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|