C26H34N2O — CID 58938576
3-ethyl-1-heptan-4-yl-5-(2,4,6-trimethylphenyl)cinnolin-4-one (PubChem CID 58938576) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is 3-ethyl-1-heptan-4-yl-5-(2,4,6-trimethylphenyl)cinnolin-4-one.
| Compound Name | 3-ethyl-1-heptan-4-yl-5-(2,4,6-trimethylphenyl)cinnolin-4-one |
|---|---|
| PubChem CID | 58938576 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 3-ethyl-1-heptan-4-yl-5-(2,4,6-trimethylphenyl)cinnolin-4-one |
| SMILES | CCCC(CCC)n1nc(CC)c(=O)c2c(-c3c(C)cc(C)cc3C)cccc21 |
| InChI | InChI=1S/C26H34N2O/c1-7-11-20(12-8-2)28-23-14-10-13-21(25(23)26(29)22(9-3)27-28)24-18(5)15-17(4)16-19(24)6/h10,13-16,20H,7-9,11-12H2,1-6H3 |
| InChIKey | CPFLZBQYOQISLO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |