C40H18F18N2Pt — CID 58939567
bis(2-[4-[2,6-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-6-id-1-yl]pyridine);platinum(2+) (PubChem CID 58939567) has the molecular formula C40H18F18N2Pt and a molecular weight of 1063.64 g/mol. Its IUPAC name is bis(2-[4-[2,6-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-6-id-1-yl]pyridine);platinum(2+).
| Compound Name | bis(2-[4-[2,6-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-6-id-1-yl]pyridine);platinum(2+) |
|---|---|
| PubChem CID | 58939567 |
| Molecular Formula | C40H18F18N2Pt |
| Molecular Weight | 1063.64 g/mol |
| Exact Mass | 1063.08 |
| IUPAC Name | bis(2-[4-[2,6-bis(trifluoromethyl)phenyl]-3-(trifluoromethyl)benzene-6-id-1-yl]pyridine);platinum(2+) |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)[c-]cc1-c1c(C(F)(F)F)cccc1C(F)(F)F.FC(F)(F)c1cc(-c2ccccn2)[c-]cc1-c1c(C(F)(F)F)cccc1C(F)(F)F.[Pt+2] |
| InChI | InChI=1S/2C20H9F9N.Pt/c2*21-18(22,23)13-4-3-5-14(19(24,25)26)17(13)12-8-7-11(10-15(12)20(27,28)29)16-6-1-2-9-30-16;/h2*1-6,8-10H;/q2*-1;+2 |
| InChIKey | FKUWDTBGYFWQEF-UHFFFAOYSA-N |
| XLogP | 14.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.64 |
| LogP ≤ 5 | 14.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|