C14H24N4O5S — CID 58940036
N-butyl-1-[(3R,4S,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methylsulfanyloxan-4-yl]triazole-4-carboxamide (PubChem CID 58940036) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-butyl-1-[(3R,4S,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methylsulfanyloxan-4-yl]triazole-4-carboxamide.
| Compound Name | N-butyl-1-[(3R,4S,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methylsulfanyloxan-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 58940036 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-butyl-1-[(3R,4S,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-methylsulfanyloxan-4-yl]triazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1cn([C@@H]2C(O)[C@H](SC)OC(CO)[C@@H]2O)nn1 |
| InChI | InChI=1S/C14H24N4O5S/c1-3-4-5-15-13(22)8-6-18(17-16-8)10-11(20)9(7-19)23-14(24-2)12(10)21/h6,9-12,14,19-21H,3-5,7H2,1-2H3,(H,15,22)/t9?,10-,11-,12?,14-/m0/s1 |
| InChIKey | MXYUMBCDPIFURO-NRADZSGXSA-N |
| XLogP | -0.85 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|