C27H42O5 — CID 58942702
(3R,4S,5S,6S)-2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-(hydroxymethyl)-5-methyloxane-3,4-diol (PubChem CID 58942702) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is (3R,4S,5S,6S)-2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-(hydroxymethyl)-5-methyloxane-3,4-diol.
| Compound Name | (3R,4S,5S,6S)-2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-(hydroxymethyl)-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 58942702 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (3R,4S,5S,6S)-2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-6-(hydroxymethyl)-5-methyloxane-3,4-diol |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC2O[C@H](CO)[C@@H](C)[C@H](O)[C@H]2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C27H42O5/c1-18(12-13-22-20(3)11-8-15-27(22,5)6)9-7-10-19(2)14-16-31-26-25(30)24(29)21(4)23(17-28)32-26/h7,9-10,12-14,21,23-26,28-30H,8,11,15-17H2,1-6H3/b10-7+,13-12+,18-9+,19-14+/t21-,23-,24+,25-,26?/m1/s1 |
| InChIKey | BUKAFWAWCROKCS-ANVKACBBSA-N |
| XLogP | 4.61 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|