C12H7N3O — CID 58943947
8-oxa-2,4,10-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene (PubChem CID 58943947) has the molecular formula C12H7N3O and a molecular weight of 209.21 g/mol. Its IUPAC name is 8-oxa-2,4,10-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene.
| Compound Name | 8-oxa-2,4,10-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene |
|---|---|
| PubChem CID | 58943947 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 8-oxa-2,4,10-triazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7(11),9,12,14-heptaene |
| SMILES | c1ccc2c(c1)c1ncoc1c1cncn21 |
| InChI | InChI=1S/C12H7N3O/c1-2-4-9-8(3-1)11-12(16-7-14-11)10-5-13-6-15(9)10/h1-7H |
| InChIKey | AKNNBLLBOQOQKS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |