C17H24N2O2S — CID 58946504
S-ethyl 2-[(5S)-2-acetyl-5-(2-phenylethyl)pyrazolidin-3-yl]ethanethioate (PubChem CID 58946504) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is S-ethyl 2-[(5S)-2-acetyl-5-(2-phenylethyl)pyrazolidin-3-yl]ethanethioate.
| Compound Name | S-ethyl 2-[(5S)-2-acetyl-5-(2-phenylethyl)pyrazolidin-3-yl]ethanethioate |
|---|---|
| PubChem CID | 58946504 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | S-ethyl 2-[(5S)-2-acetyl-5-(2-phenylethyl)pyrazolidin-3-yl]ethanethioate |
| SMILES | CCSC(=O)CC1C[C@H](CCc2ccccc2)NN1C(C)=O |
| InChI | InChI=1S/C17H24N2O2S/c1-3-22-17(21)12-16-11-15(18-19(16)13(2)20)10-9-14-7-5-4-6-8-14/h4-8,15-16,18H,3,9-12H2,1-2H3/t15-,16?/m0/s1 |
| InChIKey | XSHCGVMYFXLPJO-VYRBHSGPSA-N |
| XLogP | 2.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|