C16H24BrN — CID 58946601
(2R)-6-(bromomethyl)-1-butyl-2,3,3-trimethyl-2H-indole (PubChem CID 58946601) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is (2R)-6-(bromomethyl)-1-butyl-2,3,3-trimethyl-2H-indole.
| Compound Name | (2R)-6-(bromomethyl)-1-butyl-2,3,3-trimethyl-2H-indole |
|---|---|
| PubChem CID | 58946601 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R)-6-(bromomethyl)-1-butyl-2,3,3-trimethyl-2H-indole |
| SMILES | CCCCN1c2cc(CBr)ccc2C(C)(C)[C@H]1C |
| InChI | InChI=1S/C16H24BrN/c1-5-6-9-18-12(2)16(3,4)14-8-7-13(11-17)10-15(14)18/h7-8,10,12H,5-6,9,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | QAOMCIULKJRYEC-GFCCVEGCSA-N |
| XLogP | 4.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|