C14H15Cl3N4O — CID 58947095
O-[3-[[4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-yl]amino]propyl]hydroxylamine (PubChem CID 58947095) has the molecular formula C14H15Cl3N4O and a molecular weight of 361.66 g/mol. Its IUPAC name is O-[3-[[4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-yl]amino]propyl]hydroxylamine.
| Compound Name | O-[3-[[4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-yl]amino]propyl]hydroxylamine |
|---|---|
| PubChem CID | 58947095 |
| Molecular Formula | C14H15Cl3N4O |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | O-[3-[[4-chloro-6-[(2,6-dichlorophenyl)methyl]pyrimidin-2-yl]amino]propyl]hydroxylamine |
| SMILES | NOCCCNc1nc(Cl)cc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C14H15Cl3N4O/c15-11-3-1-4-12(16)10(11)7-9-8-13(17)21-14(20-9)19-5-2-6-22-18/h1,3-4,8H,2,5-7,18H2,(H,19,20,21) |
| InChIKey | BBNUHSCQIUVYIR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|