C13H24N2 — CID 58949437
N,N-dimethyl-1-(4-methylpent-2-ynyl)piperidin-4-amine (PubChem CID 58949437) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-dimethyl-1-(4-methylpent-2-ynyl)piperidin-4-amine.
| Compound Name | N,N-dimethyl-1-(4-methylpent-2-ynyl)piperidin-4-amine |
|---|---|
| PubChem CID | 58949437 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-dimethyl-1-(4-methylpent-2-ynyl)piperidin-4-amine |
| SMILES | CC(C)C#CCN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-12(2)6-5-9-15-10-7-13(8-11-15)14(3)4/h12-13H,7-11H2,1-4H3 |
| InChIKey | PDKPRIOXSIETIF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|