C22H19I2S+ — CID 58952765
5-(4-tert-butylphenyl)-2,8-diiododibenzothiophen-5-ium (PubChem CID 58952765) has the molecular formula C22H19I2S+ and a molecular weight of 569.27 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2,8-diiododibenzothiophen-5-ium.
| Compound Name | 5-(4-tert-butylphenyl)-2,8-diiododibenzothiophen-5-ium |
|---|---|
| PubChem CID | 58952765 |
| Molecular Formula | C22H19I2S+ |
| Molecular Weight | 569.27 g/mol |
| Exact Mass | 568.93 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2,8-diiododibenzothiophen-5-ium |
| SMILES | CC(C)(C)c1ccc(-[s+]2c3ccc(I)cc3c3cc(I)ccc32)cc1 |
| InChI | InChI=1S/C22H19I2S/c1-22(2,3)14-4-8-17(9-5-14)25-20-10-6-15(23)12-18(20)19-13-16(24)7-11-21(19)25/h4-13H,1-3H3/q+1 |
| InChIKey | ILDOHCUEESYYND-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.27 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|