C18H10FI2S+ — CID 163823538
5-(4-fluorophenyl)-2,8-diiododibenzothiophen-5-ium (PubChem CID 163823538) has the molecular formula C18H10FI2S+ and a molecular weight of 531.15 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2,8-diiododibenzothiophen-5-ium.
| Compound Name | 5-(4-fluorophenyl)-2,8-diiododibenzothiophen-5-ium |
|---|---|
| PubChem CID | 163823538 |
| Molecular Formula | C18H10FI2S+ |
| Molecular Weight | 531.15 g/mol |
| Exact Mass | 530.86 |
| IUPAC Name | 5-(4-fluorophenyl)-2,8-diiododibenzothiophen-5-ium |
| SMILES | Fc1ccc(-[s+]2c3ccc(I)cc3c3cc(I)ccc32)cc1 |
| InChI | InChI=1S/C18H10FI2S/c19-11-1-5-14(6-2-11)22-17-7-3-12(20)9-15(17)16-10-13(21)4-8-18(16)22/h1-10H/q+1 |
| InChIKey | NXLSLTZMZCHAQT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.15 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|