About carbanide;methyl 2-phenylacetate;yttrium
carbanide;methyl 2-phenylacetate;yttrium (PubChem CID 58955994) has the molecular formula C10H12O2Y-2
and a molecular weight of 253.11 g/mol. Its IUPAC name is carbanide;methyl 2-phenylacetate;yttrium.
Molecular Properties
| Compound Name | carbanide;methyl 2-phenylacetate;yttrium |
| PubChem CID | 58955994 |
| Molecular Formula | C10H12O2Y-2 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | carbanide;methyl 2-phenylacetate;yttrium |
| SMILES | COC(=O)Cc1cc[c-]cc1.[CH3-].[Y] |
| InChI | InChI=1S/C9H9O2.CH3.Y/c1-11-9(10)7-8-5-3-2-4-6-8;;/h3-6H,7H2,1H3;1H3;/q2*-1; |
| InChIKey | ZGTSDCXRWWYBFG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methyl 2-phenylacetate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methyl 2-phenylacetate;yttrium?
The IUPAC name of carbanide;methyl 2-phenylacetate;yttrium (CID 58955994) is carbanide;methyl 2-phenylacetate;yttrium.
What is the SMILES notation for carbanide;methyl 2-phenylacetate;yttrium?
The canonical SMILES for carbanide;methyl 2-phenylacetate;yttrium is COC(=O)Cc1cc[c-]cc1.[CH3-].[Y].
What is the InChIKey of carbanide;methyl 2-phenylacetate;yttrium?
The InChIKey is ZGTSDCXRWWYBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9O2.CH3.Y/c1-11-9(10)7-8-5-3-2-4-6-8;;/h3-6H,7H2,1H3;1H3;/q2*-1;.
What are the key properties of carbanide;methyl 2-phenylacetate;yttrium?
carbanide;methyl 2-phenylacetate;yttrium has a molecular weight of 253.11 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methyl 2-phenylacetate;yttrium is sourced from PubChem (CID 58955994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).