C27H32F3N3O2 — CID 58956675
N-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 58956675) has the molecular formula C27H32F3N3O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is N-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 58956675 |
| Molecular Formula | C27H32F3N3O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32F3N3O2/c1-17(34)31-20-11-13-33(14-12-20)16-21-8-9-22-25(18-5-3-2-4-6-18)32-24-10-7-19(27(28,29)30)15-23(24)26(22)35-21/h2-7,10,15,20-22,25-26,32H,8-9,11-14,16H2,1H3,(H,31,34)/t21-,22+,25+,26+/m1/s1 |
| InChIKey | XOSBRCYOKQWQAR-HRHCJDDBSA-N |
| XLogP | 5.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |